C44H27N5O2 — CID 174442972
2-nitro-3,5,7,8-tetraphenylporphyrin (PubChem CID 174442972) has the molecular formula C44H27N5O2 and a molecular weight of 657.73 g/mol. Its IUPAC name is 2-nitro-3,5,7,8-tetraphenylporphyrin.
| Compound Name | 2-nitro-3,5,7,8-tetraphenylporphyrin |
|---|---|
| PubChem CID | 174442972 |
| Molecular Formula | C44H27N5O2 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.22 |
| IUPAC Name | 2-nitro-3,5,7,8-tetraphenylporphyrin |
| SMILES | O=[N+]([O-])C1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C44H27N5O2/c50-49(51)44-37-27-35-24-22-33(46-35)25-32-21-23-34(45-32)26-36-38(28-13-5-1-6-14-28)39(29-15-7-2-8-16-29)42(47-36)40(30-17-9-3-10-18-30)43(48-37)41(44)31-19-11-4-12-20-31/h1-27H/b32-25-,33-25-,34-26-,35-27-,36-26-,37-27-,42-40-,43-40- |
| InChIKey | XNWABOUYYSCXKW-QTUHVXTLSA-N |
| XLogP | 9.29 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|