About diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid
diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid (PubChem CID 174442978) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid |
| PubChem CID | 174442978 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1.O=C1CCC(C(=O)O)N1 |
| InChI | InChI=1S/C13H10O.C5H7NO3/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-4-2-1-3(6-4)5(8)9/h1-10H;3H,1-2H2,(H,6,7)(H,8,9) |
| InChIKey | ONLXHIYAXPCAQX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid?
The IUPAC name of diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid (CID 174442978) is diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid.
What is the SMILES notation for diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid?
The canonical SMILES for diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid is O=C(c1ccccc1)c1ccccc1.O=C1CCC(C(=O)O)N1.
What is the InChIKey of diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid?
The InChIKey is ONLXHIYAXPCAQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C5H7NO3/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-4-2-1-3(6-4)5(8)9/h1-10H;3H,1-2H2,(H,6,7)(H,8,9).
What are the key properties of diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid?
diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid has a molecular weight of 311.34 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;5-oxopyrrolidine-2-carboxylic acid is sourced from PubChem (CID 174442978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).