C43H39NO5S — CID 174443889
4-[(E)-2-[1-[5,5,8,8-tetramethyl-3-[(E)-2-(sulfoamino)ethenyl]-6,7-dihydrochrysen-2-yl]naphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 174443889) has the molecular formula C43H39NO5S and a molecular weight of 681.85 g/mol. Its IUPAC name is 4-[(E)-2-[1-[5,5,8,8-tetramethyl-3-[(E)-2-(sulfoamino)ethenyl]-6,7-dihydrochrysen-2-yl]naphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[1-[5,5,8,8-tetramethyl-3-[(E)-2-(sulfoamino)ethenyl]-6,7-dihydrochrysen-2-yl]naphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 174443889 |
| Molecular Formula | C43H39NO5S |
| Molecular Weight | 681.85 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | 4-[(E)-2-[1-[5,5,8,8-tetramethyl-3-[(E)-2-(sulfoamino)ethenyl]-6,7-dihydrochrysen-2-yl]naphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CC1(C)C=CC2=C(C1)CC(C)(C)c1c2ccc2cc(-c3c(/C=C/c4ccc(C(=O)O)cc4)ccc4ccccc34)c(/C=C/NS(=O)(=O)O)cc12 |
| InChI | InChI=1S/C43H39NO5S/c1-42(2)21-19-34-33(25-42)26-43(3,4)40-36(34)18-17-31-23-37(32(24-38(31)40)20-22-44-50(47,48)49)39-29(16-15-28-7-5-6-8-35(28)39)12-9-27-10-13-30(14-11-27)41(45)46/h5-24,44H,25-26H2,1-4H3,(H,45,46)(H,47,48,49)/b12-9+,22-20+ |
| InChIKey | AJTOMNXNJGRSAI-IKPDZOKZSA-N |
| XLogP | 10.31 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.85 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|