About 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde
2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde (PubChem CID 174444496) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde |
| PubChem CID | 174444496 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)OC(=O)C(C=O)O1 |
| InChI | InChI=1S/C6H8O4/c1-6(2)9-4(3-7)5(8)10-6/h3-4H,1-2H3 |
| InChIKey | GEJSHIQKVXRQAI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde?
The IUPAC name of 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde (CID 174444496) is 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde.
What is the SMILES notation for 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde?
The canonical SMILES for 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde is CC1(C)OC(=O)C(C=O)O1.
What is the InChIKey of 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde?
The InChIKey is GEJSHIQKVXRQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-6(2)9-4(3-7)5(8)10-6/h3-4H,1-2H3.
What are the key properties of 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde?
2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde has a molecular weight of 144.13 g/mol, XLogP of -0.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-oxo-1,3-dioxolane-4-carbaldehyde is sourced from PubChem (CID 174444496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).