About buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile
buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile (PubChem CID 174444514) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile |
| PubChem CID | 174444514 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile |
| SMILES | C=C(C)C#N.C=CC(=C)C.C=CC=C |
| InChI | InChI=1S/C5H8.C4H5N.C4H6/c1-4-5(2)3;1-4(2)3-5;1-3-4-2/h4H,1-2H2,3H3;1H2,2H3;3-4H,1-2H2 |
| InChIKey | CULQPYNFIWWSKW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
The IUPAC name of buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile (CID 174444514) is buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile.
What is the SMILES notation for buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
The canonical SMILES for buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile is C=C(C)C#N.C=CC(=C)C.C=CC=C.
What is the InChIKey of buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
The InChIKey is CULQPYNFIWWSKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.C4H5N.C4H6/c1-4-5(2)3;1-4(2)3-5;1-3-4-2/h4H,1-2H2,3H3;1H2,2H3;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile has a molecular weight of 189.30 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;2-methylbuta-1,3-diene;2-methylprop-2-enenitrile is sourced from PubChem (CID 174444514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).