About bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide
bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide (PubChem CID 174444580) has the molecular formula C9H11IO
and a molecular weight of 262.09 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide |
| PubChem CID | 174444580 |
| Molecular Formula | C9H11IO |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide |
| SMILES | CCC=O.I.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.C3H6O.HI/c1-2-6-4-3-5(1)6;1-2-3-4;/h1-4H;3H,2H2,1H3;1H |
| InChIKey | BLIRRXXVNTWPKH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide (CID 174444580) is bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide is CCC=O.I.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide?
The InChIKey is BLIRRXXVNTWPKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C3H6O.HI/c1-2-6-4-3-5(1)6;1-2-3-4;/h1-4H;3H,2H2,1H3;1H.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide?
bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide has a molecular weight of 262.09 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;propanal;hydroiodide is sourced from PubChem (CID 174444580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).