C38H32BrN3O2 — CID 174444613
6-bromo-N-[1-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydrochrysen-3-amine;9H-carbazole (PubChem CID 174444613) has the molecular formula C38H32BrN3O2 and a molecular weight of 642.60 g/mol. Its IUPAC name is 6-bromo-N-[1-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydrochrysen-3-amine;9H-carbazole.
| Compound Name | 6-bromo-N-[1-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydrochrysen-3-amine;9H-carbazole |
|---|---|
| PubChem CID | 174444613 |
| Molecular Formula | C38H32BrN3O2 |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | 6-bromo-N-[1-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydrochrysen-3-amine;9H-carbazole |
| SMILES | CC(NC1CCc2ccc3c(cc(Br)c4ccccc43)c2C1)c1ccc([N+](=O)[O-])cc1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C26H23BrN2O2.C12H9N/c1-16(17-7-11-20(12-8-17)29(30)31)28-19-10-6-18-9-13-22-21-4-2-3-5-23(21)26(27)15-25(22)24(18)14-19;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h2-5,7-9,11-13,15-16,19,28H,6,10,14H2,1H3;1-8,13H |
| InChIKey | AHBFDEOMVGLMTN-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 70.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|