C19H18F3NO2 — CID 174444790
3,3,3-trifluoro-2-hydroxy-2-methyl-N-[2-methyl-4-[(E)-2-phenylethenyl]phenyl]propanamide (PubChem CID 174444790) has the molecular formula C19H18F3NO2 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-2-methyl-N-[2-methyl-4-[(E)-2-phenylethenyl]phenyl]propanamide.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-2-methyl-N-[2-methyl-4-[(E)-2-phenylethenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 174444790 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-2-methyl-N-[2-methyl-4-[(E)-2-phenylethenyl]phenyl]propanamide |
| SMILES | Cc1cc(/C=C/c2ccccc2)ccc1NC(=O)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO2/c1-13-12-15(9-8-14-6-4-3-5-7-14)10-11-16(13)23-17(24)18(2,25)19(20,21)22/h3-12,25H,1-2H3,(H,23,24)/b9-8+ |
| InChIKey | WPWCTEHVYIALIW-CMDGGOBGSA-N |
| XLogP | 4.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|