About 1,4-dichlorobenzene;formonitrile
1,4-dichlorobenzene;formonitrile (PubChem CID 174444870) has the molecular formula C7H5Cl2N
and a molecular weight of 174.03 g/mol. Its IUPAC name is 1,4-dichlorobenzene;formonitrile.
Molecular Properties
| Compound Name | 1,4-dichlorobenzene;formonitrile |
| PubChem CID | 174444870 |
| Molecular Formula | C7H5Cl2N |
| Molecular Weight | 174.03 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | 1,4-dichlorobenzene;formonitrile |
| SMILES | C#N.Clc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H4Cl2.CHN/c7-5-1-2-6(8)4-3-5;1-2/h1-4H;1H |
| InChIKey | OVMJMZSUUDHJSC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.03 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-dichlorobenzene;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichlorobenzene;formonitrile?
The IUPAC name of 1,4-dichlorobenzene;formonitrile (CID 174444870) is 1,4-dichlorobenzene;formonitrile.
What is the SMILES notation for 1,4-dichlorobenzene;formonitrile?
The canonical SMILES for 1,4-dichlorobenzene;formonitrile is C#N.Clc1ccc(Cl)cc1.
What is the InChIKey of 1,4-dichlorobenzene;formonitrile?
The InChIKey is OVMJMZSUUDHJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.CHN/c7-5-1-2-6(8)4-3-5;1-2/h1-4H;1H.
What are the key properties of 1,4-dichlorobenzene;formonitrile?
1,4-dichlorobenzene;formonitrile has a molecular weight of 174.03 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichlorobenzene;formonitrile is sourced from PubChem (CID 174444870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).