C27H29BrN2O3 — CID 174445242
N-benzyl-2-(3-bromophenyl)-N-[(2S,4R)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]acetamide (PubChem CID 174445242) has the molecular formula C27H29BrN2O3 and a molecular weight of 509.44 g/mol. Its IUPAC name is N-benzyl-2-(3-bromophenyl)-N-[(2S,4R)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]acetamide.
| Compound Name | N-benzyl-2-(3-bromophenyl)-N-[(2S,4R)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]acetamide |
|---|---|
| PubChem CID | 174445242 |
| Molecular Formula | C27H29BrN2O3 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N-benzyl-2-(3-bromophenyl)-N-[(2S,4R)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]acetamide |
| SMILES | COc1cc2c(cc1OC)[C@H](N(Cc1ccccc1)C(=O)Cc1cccc(Br)c1)C[C@H](C)N2 |
| InChI | InChI=1S/C27H29BrN2O3/c1-18-12-24(22-15-25(32-2)26(33-3)16-23(22)29-18)30(17-19-8-5-4-6-9-19)27(31)14-20-10-7-11-21(28)13-20/h4-11,13,15-16,18,24,29H,12,14,17H2,1-3H3/t18-,24+/m0/s1 |
| InChIKey | VLTHAMMTUCWFST-MHECFPHRSA-N |
| XLogP | 5.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|