About hydrazine;6-methyl-1,3-benzoxazole
hydrazine;6-methyl-1,3-benzoxazole (PubChem CID 174445357) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is hydrazine;6-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | hydrazine;6-methyl-1,3-benzoxazole |
| PubChem CID | 174445357 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | hydrazine;6-methyl-1,3-benzoxazole |
| SMILES | Cc1ccc2ncoc2c1.NN |
| InChI | InChI=1S/C8H7NO.H4N2/c1-6-2-3-7-8(4-6)10-5-9-7;1-2/h2-5H,1H3;1-2H2 |
| InChIKey | NTWMBHULIRBTGD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;6-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;6-methyl-1,3-benzoxazole?
The IUPAC name of hydrazine;6-methyl-1,3-benzoxazole (CID 174445357) is hydrazine;6-methyl-1,3-benzoxazole.
What is the SMILES notation for hydrazine;6-methyl-1,3-benzoxazole?
The canonical SMILES for hydrazine;6-methyl-1,3-benzoxazole is Cc1ccc2ncoc2c1.NN.
What is the InChIKey of hydrazine;6-methyl-1,3-benzoxazole?
The InChIKey is NTWMBHULIRBTGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.H4N2/c1-6-2-3-7-8(4-6)10-5-9-7;1-2/h2-5H,1H3;1-2H2.
What are the key properties of hydrazine;6-methyl-1,3-benzoxazole?
hydrazine;6-methyl-1,3-benzoxazole has a molecular weight of 165.20 g/mol, XLogP of 0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;6-methyl-1,3-benzoxazole is sourced from PubChem (CID 174445357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).