C14H23AlF6 — CID 174445550
1-(2,3,4,5,6,9-hexafluorononyl)aluminane (PubChem CID 174445550) has the molecular formula C14H23AlF6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1-(2,3,4,5,6,9-hexafluorononyl)aluminane.
| Compound Name | 1-(2,3,4,5,6,9-hexafluorononyl)aluminane |
|---|---|
| PubChem CID | 174445550 |
| Molecular Formula | C14H23AlF6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-(2,3,4,5,6,9-hexafluorononyl)aluminane |
| SMILES | FCCCC(F)C(F)C(F)C(F)C(F)C[Al]1CCCCC1 |
| InChI | InChI=1S/C9H13F6.C5H10.Al/c1-5(11)7(13)9(15)8(14)6(12)3-2-4-10;1-3-5-4-2;/h5-9H,1-4H2;1-5H2; |
| InChIKey | SBWWWCXWWIJEPW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |