About benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium
benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium (PubChem CID 174445897) has the molecular formula C17H21N2S+
and a molecular weight of 285.44 g/mol. Its IUPAC name is benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium.
Molecular Properties
| Compound Name | benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium |
| PubChem CID | 174445897 |
| Molecular Formula | C17H21N2S+ |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium |
| SMILES | Cc1ccccc1C=[N+](C)C.NC(=S)c1ccccc1 |
| InChI | InChI=1S/C10H14N.C7H7NS/c1-9-6-4-5-7-10(9)8-11(2)3;8-7(9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H,(H2,8,9)/q+1; |
| InChIKey | CSOSMEJHZHUYKU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium?
The IUPAC name of benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium (CID 174445897) is benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium.
What is the SMILES notation for benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium?
The canonical SMILES for benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium is Cc1ccccc1C=[N+](C)C.NC(=S)c1ccccc1.
What is the InChIKey of benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium?
The InChIKey is CSOSMEJHZHUYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N.C7H7NS/c1-9-6-4-5-7-10(9)8-11(2)3;8-7(9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H,(H2,8,9)/q+1;.
What are the key properties of benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium?
benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium has a molecular weight of 285.44 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioamide;dimethyl-[(2-methylphenyl)methylidene]azanium is sourced from PubChem (CID 174445897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).