About tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate
tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate (PubChem CID 174446374) has the molecular formula C14H17N3O2S
and a molecular weight of 291.38 g/mol. Its IUPAC name is tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate.
Molecular Properties
| Compound Name | tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate |
| PubChem CID | 174446374 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2csc(N)n2)c(N)c1 |
| InChI | InChI=1S/C14H17N3O2S/c1-14(2,3)19-12(18)8-4-5-9(10(15)6-8)11-7-20-13(16)17-11/h4-7H,15H2,1-3H3,(H2,16,17) |
| InChIKey | SZQAGJSGIRTSKR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate?
The IUPAC name of tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate (CID 174446374) is tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate.
What is the SMILES notation for tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate?
The canonical SMILES for tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate is CC(C)(C)OC(=O)c1ccc(-c2csc(N)n2)c(N)c1.
What is the InChIKey of tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate?
The InChIKey is SZQAGJSGIRTSKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2S/c1-14(2,3)19-12(18)8-4-5-9(10(15)6-8)11-7-20-13(16)17-11/h4-7H,15H2,1-3H3,(H2,16,17).
What are the key properties of tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate?
tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate has a molecular weight of 291.38 g/mol, XLogP of 2.93, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-amino-4-(2-amino-1,3-thiazol-4-yl)benzoate is sourced from PubChem (CID 174446374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).