C27H26F3N3O2 — CID 174446525
3-[1-[(2,4-difluoro-3-methoxyphenyl)-fluoromethyl]piperidin-4-yl]-4-phenyl-1,4-dihydroquinazolin-2-one (PubChem CID 174446525) has the molecular formula C27H26F3N3O2 and a molecular weight of 481.52 g/mol. Its IUPAC name is 3-[1-[(2,4-difluoro-3-methoxyphenyl)-fluoromethyl]piperidin-4-yl]-4-phenyl-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-[1-[(2,4-difluoro-3-methoxyphenyl)-fluoromethyl]piperidin-4-yl]-4-phenyl-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 174446525 |
| Molecular Formula | C27H26F3N3O2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-[1-[(2,4-difluoro-3-methoxyphenyl)-fluoromethyl]piperidin-4-yl]-4-phenyl-1,4-dihydroquinazolin-2-one |
| SMILES | COc1c(F)ccc(C(F)N2CCC(N3C(=O)Nc4ccccc4C3c3ccccc3)CC2)c1F |
| InChI | InChI=1S/C27H26F3N3O2/c1-35-25-21(28)12-11-20(23(25)29)26(30)32-15-13-18(14-16-32)33-24(17-7-3-2-4-8-17)19-9-5-6-10-22(19)31-27(33)34/h2-12,18,24,26H,13-16H2,1H3,(H,31,34) |
| InChIKey | RFVXOLXYICXYIT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|