About N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline
N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline (PubChem CID 174446584) has the molecular formula C25H24F6N4
and a molecular weight of 494.48 g/mol. Its IUPAC name is N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline.
Molecular Properties
| Compound Name | N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline |
| PubChem CID | 174446584 |
| Molecular Formula | C25H24F6N4 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline |
| SMILES | Cc1ccc(F)cc1N.FN(F)c1ccccc1.Nc1cc(F)cc(F)c1.Nc1cccc(F)c1 |
| InChI | InChI=1S/C7H8FN.2C6H5F2N.C6H6FN/c1-5-2-3-6(8)4-7(5)9;7-4-1-5(8)3-6(9)2-4;7-9(8)6-4-2-1-3-5-6;7-5-2-1-3-6(8)4-5/h2-4H,9H2,1H3;1-3H,9H2;1-5H;1-4H,8H2 |
| InChIKey | SBHFMQUKRQXYIJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline?
The IUPAC name of N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline (CID 174446584) is N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline.
What is the SMILES notation for N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline?
The canonical SMILES for N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline is Cc1ccc(F)cc1N.FN(F)c1ccccc1.Nc1cc(F)cc(F)c1.Nc1cccc(F)c1.
What is the InChIKey of N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline?
The InChIKey is SBHFMQUKRQXYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN.2C6H5F2N.C6H6FN/c1-5-2-3-6(8)4-7(5)9;7-4-1-5(8)3-6(9)2-4;7-9(8)6-4-2-1-3-5-6;7-5-2-1-3-6(8)4-5/h2-4H,9H2,1H3;1-3H,9H2;1-5H;1-4H,8H2.
What are the key properties of N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline?
N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline has a molecular weight of 494.48 g/mol, XLogP of 6.93, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-difluoroaniline;3,5-difluoroaniline;3-fluoroaniline;5-fluoro-2-methylaniline is sourced from PubChem (CID 174446584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).