C18H15Cl2N3O2 — CID 174446774
2-[4-[1-chloro-2-(4-chlorophenyl)propan-2-yl]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 174446774) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-[4-[1-chloro-2-(4-chlorophenyl)propan-2-yl]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[1-chloro-2-(4-chlorophenyl)propan-2-yl]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 174446774 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-[4-[1-chloro-2-(4-chlorophenyl)propan-2-yl]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC(CCl)(c1ccc(Cl)cc1)c1ccc(-n2ncc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-18(11-19,12-2-6-14(20)7-3-12)13-4-8-15(9-5-13)23-17(25)22-16(24)10-21-23/h2-10H,11H2,1H3,(H,22,24,25) |
| InChIKey | DMJVQKLXHSFOCJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|