C20H21N5OS — CID 17444722
1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone (PubChem CID 17444722) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone.
| Compound Name | 1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 17444722 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)ethanone |
| SMILES | Cc1cc(C(=O)CSc2nnc3c(n2)[nH]c2ccccc23)c(C)n1C(C)C |
| InChI | InChI=1S/C20H21N5OS/c1-11(2)25-12(3)9-15(13(25)4)17(26)10-27-20-22-19-18(23-24-20)14-7-5-6-8-16(14)21-19/h5-9,11H,10H2,1-4H3,(H,21,22,24) |
| InChIKey | KWVSACPTDHDUBV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_656b(3)', 'substructure': 'N/A'} |
|---|