C12H2Cl12O — CID 174447224
bis(1,2,3,4,5,6-hexachlorobenzene);hydrate (PubChem CID 174447224) has the molecular formula C12H2Cl12O and a molecular weight of 587.58 g/mol. Its IUPAC name is bis(1,2,3,4,5,6-hexachlorobenzene);hydrate.
| Compound Name | bis(1,2,3,4,5,6-hexachlorobenzene);hydrate |
|---|---|
| PubChem CID | 174447224 |
| Molecular Formula | C12H2Cl12O |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 581.64 |
| IUPAC Name | bis(1,2,3,4,5,6-hexachlorobenzene);hydrate |
| SMILES | Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.O |
| InChI | InChI=1S/2C6Cl6.H2O/c2*7-1-2(8)4(10)6(12)5(11)3(1)9;/h;;1H2 |
| InChIKey | GONJOQRRHDTJGY-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|