About (6-oxopiperazin-2-yl) acetate
(6-oxopiperazin-2-yl) acetate (PubChem CID 174447712) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is (6-oxopiperazin-2-yl) acetate.
Molecular Properties
| Compound Name | (6-oxopiperazin-2-yl) acetate |
| PubChem CID | 174447712 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (6-oxopiperazin-2-yl) acetate |
| SMILES | CC(=O)OC1CNCC(=O)N1 |
| InChI | InChI=1S/C6H10N2O3/c1-4(9)11-6-3-7-2-5(10)8-6/h6-7H,2-3H2,1H3,(H,8,10) |
| InChIKey | CGWSSBSWFYFSTQ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-oxopiperazin-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxopiperazin-2-yl) acetate?
The IUPAC name of (6-oxopiperazin-2-yl) acetate (CID 174447712) is (6-oxopiperazin-2-yl) acetate.
What is the SMILES notation for (6-oxopiperazin-2-yl) acetate?
The canonical SMILES for (6-oxopiperazin-2-yl) acetate is CC(=O)OC1CNCC(=O)N1.
What is the InChIKey of (6-oxopiperazin-2-yl) acetate?
The InChIKey is CGWSSBSWFYFSTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-4(9)11-6-3-7-2-5(10)8-6/h6-7H,2-3H2,1H3,(H,8,10).
What are the key properties of (6-oxopiperazin-2-yl) acetate?
(6-oxopiperazin-2-yl) acetate has a molecular weight of 158.16 g/mol, XLogP of -1.40, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxopiperazin-2-yl) acetate is sourced from PubChem (CID 174447712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).