About bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile
bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile (PubChem CID 174447849) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile |
| PubChem CID | 174447849 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile |
| SMILES | CN(C)C=CC#N.O=c1c2ccccc12 |
| InChI | InChI=1S/C7H4O.C5H8N2/c8-7-5-3-1-2-4-6(5)7;1-7(2)5-3-4-6/h1-4H;3,5H,1-2H3 |
| InChIKey | KPISIAAGBNMZEN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile?
The IUPAC name of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile (CID 174447849) is bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile.
What is the SMILES notation for bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile?
The canonical SMILES for bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile is CN(C)C=CC#N.O=c1c2ccccc12.
What is the InChIKey of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile?
The InChIKey is KPISIAAGBNMZEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O.C5H8N2/c8-7-5-3-1-2-4-6(5)7;1-7(2)5-3-4-6/h1-4H;3,5H,1-2H3.
What are the key properties of bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile?
bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile has a molecular weight of 200.24 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hepta-1,3,5-trien-7-one;3-(dimethylamino)prop-2-enenitrile is sourced from PubChem (CID 174447849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).