About 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol
4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol (PubChem CID 174447924) has the molecular formula C9H18FNO3
and a molecular weight of 207.24 g/mol. Its IUPAC name is 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol.
Molecular Properties
| Compound Name | 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol |
| PubChem CID | 174447924 |
| Molecular Formula | C9H18FNO3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol |
| SMILES | OCCCCN[C@H]1[C@H](F)CO[C@@H]1CO |
| InChI | InChI=1S/C9H18FNO3/c10-7-6-14-8(5-13)9(7)11-3-1-2-4-12/h7-9,11-13H,1-6H2/t7-,8-,9+/m1/s1 |
| InChIKey | CUHVKRGNJHUUDF-HLTSFMKQSA-N |
| XLogP | -0.55 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol?
The IUPAC name of 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol (CID 174447924) is 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol.
What is the SMILES notation for 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol?
The canonical SMILES for 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol is OCCCCN[C@H]1[C@H](F)CO[C@@H]1CO.
What is the InChIKey of 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol?
The InChIKey is CUHVKRGNJHUUDF-HLTSFMKQSA-N. The full InChI is InChI=1S/C9H18FNO3/c10-7-6-14-8(5-13)9(7)11-3-1-2-4-12/h7-9,11-13H,1-6H2/t7-,8-,9+/m1/s1.
What are the key properties of 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol?
4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol has a molecular weight of 207.24 g/mol, XLogP of -0.55, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2S,3R,4S)-4-fluoro-2-(hydroxymethyl)oxolan-3-yl]amino]butan-1-ol is sourced from PubChem (CID 174447924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).