About 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide
2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 174448310) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide.
Molecular Properties
| Compound Name | 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide |
| PubChem CID | 174448310 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | CC1(C)C2CCC1(CC(N)=O)C(=O)C2 |
| InChI | InChI=1S/C11H17NO2/c1-10(2)7-3-4-11(10,6-9(12)14)8(13)5-7/h7H,3-6H2,1-2H3,(H2,12,14) |
| InChIKey | QAUFIRYHEINQGM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide?
The IUPAC name of 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide (CID 174448310) is 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide.
What is the SMILES notation for 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide?
The canonical SMILES for 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide is CC1(C)C2CCC1(CC(N)=O)C(=O)C2.
What is the InChIKey of 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide?
The InChIKey is QAUFIRYHEINQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-10(2)7-3-4-11(10,6-9(12)14)8(13)5-7/h7H,3-6H2,1-2H3,(H2,12,14).
What are the key properties of 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide?
2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide has a molecular weight of 195.26 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)acetamide is sourced from PubChem (CID 174448310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).