About 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde
3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde (PubChem CID 174448676) has the molecular formula C17H14O6
and a molecular weight of 314.29 g/mol. Its IUPAC name is 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde |
| PubChem CID | 174448676 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde |
| SMILES | Cc1ccc2c(c1)C(C=O)C(O)=C(c1ccc(O)c(O)c1O)O2 |
| InChI | InChI=1S/C17H14O6/c1-8-2-5-13-10(6-8)11(7-18)15(21)17(23-13)9-3-4-12(19)16(22)14(9)20/h2-7,11,19-22H,1H3 |
| InChIKey | CPLMZGIXBSNINS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde?
The IUPAC name of 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde (CID 174448676) is 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde.
What is the SMILES notation for 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde?
The canonical SMILES for 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde is Cc1ccc2c(c1)C(C=O)C(O)=C(c1ccc(O)c(O)c1O)O2.
What is the InChIKey of 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde?
The InChIKey is CPLMZGIXBSNINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O6/c1-8-2-5-13-10(6-8)11(7-18)15(21)17(23-13)9-3-4-12(19)16(22)14(9)20/h2-7,11,19-22H,1H3.
What are the key properties of 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde?
3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde has a molecular weight of 314.29 g/mol, XLogP of 2.71, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6-methyl-2-(2,3,4-trihydroxyphenyl)-4H-chromene-4-carbaldehyde is sourced from PubChem (CID 174448676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).