About (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol
(4-cyclopentyl-1,3-thiazol-5-yl)methanethiol (PubChem CID 174448874) has the molecular formula C9H13NS2
and a molecular weight of 199.34 g/mol. Its IUPAC name is (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol.
Molecular Properties
| Compound Name | (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol |
| PubChem CID | 174448874 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol |
| SMILES | SCc1scnc1C1CCCC1 |
| InChI | InChI=1S/C9H13NS2/c11-5-8-9(10-6-12-8)7-3-1-2-4-7/h6-7,11H,1-5H2 |
| InChIKey | KKQANMACFMZUJN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol?
The IUPAC name of (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol (CID 174448874) is (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol.
What is the SMILES notation for (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol?
The canonical SMILES for (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol is SCc1scnc1C1CCCC1.
What is the InChIKey of (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol?
The InChIKey is KKQANMACFMZUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS2/c11-5-8-9(10-6-12-8)7-3-1-2-4-7/h6-7,11H,1-5H2.
What are the key properties of (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol?
(4-cyclopentyl-1,3-thiazol-5-yl)methanethiol has a molecular weight of 199.34 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopentyl-1,3-thiazol-5-yl)methanethiol is sourced from PubChem (CID 174448874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).