About [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid
[4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid (PubChem CID 174448923) has the molecular formula C11H12N2O2S3
and a molecular weight of 300.43 g/mol. Its IUPAC name is [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid.
Molecular Properties
| Compound Name | [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid |
| PubChem CID | 174448923 |
| Molecular Formula | C11H12N2O2S3 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid |
| SMILES | O=S(O)CNc1ccc(-c2ncsc2CS)cc1 |
| InChI | InChI=1S/C11H12N2O2S3/c14-18(15)7-13-9-3-1-8(2-4-9)11-10(5-16)17-6-12-11/h1-4,6,13,16H,5,7H2,(H,14,15) |
| InChIKey | UXTILRBCRSJCCW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid?
The IUPAC name of [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid (CID 174448923) is [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid.
What is the SMILES notation for [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid?
The canonical SMILES for [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid is O=S(O)CNc1ccc(-c2ncsc2CS)cc1.
What is the InChIKey of [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid?
The InChIKey is UXTILRBCRSJCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S3/c14-18(15)7-13-9-3-1-8(2-4-9)11-10(5-16)17-6-12-11/h1-4,6,13,16H,5,7H2,(H,14,15).
What are the key properties of [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid?
[4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid has a molecular weight of 300.43 g/mol, XLogP of 2.83, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(sulfanylmethyl)-1,3-thiazol-4-yl]anilino]methanesulfinic acid is sourced from PubChem (CID 174448923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).