C6H14N2O — CID 174449150
N'-methyl-1-prop-2-enoxyethane-1,2-diamine (PubChem CID 174449150) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is N'-methyl-1-prop-2-enoxyethane-1,2-diamine.
| Compound Name | N'-methyl-1-prop-2-enoxyethane-1,2-diamine |
|---|---|
| PubChem CID | 174449150 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | N'-methyl-1-prop-2-enoxyethane-1,2-diamine |
| SMILES | C=CCOC(N)CNC |
| InChI | InChI=1S/C6H14N2O/c1-3-4-9-6(7)5-8-2/h3,6,8H,1,4-5,7H2,2H3 |
| InChIKey | QVINUPWJLYJRCB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|