About bromobenzene;2H-chromene
bromobenzene;2H-chromene (PubChem CID 174449384) has the molecular formula C15H13BrO
and a molecular weight of 289.17 g/mol. Its IUPAC name is bromobenzene;2H-chromene.
Molecular Properties
| Compound Name | bromobenzene;2H-chromene |
| PubChem CID | 174449384 |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | bromobenzene;2H-chromene |
| SMILES | Brc1ccccc1.C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C9H8O.C6H5Br/c1-2-6-9-8(4-1)5-3-7-10-9;7-6-4-2-1-3-5-6/h1-6H,7H2;1-5H |
| InChIKey | NQZPCXRNJWANQE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bromobenzene;2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;2H-chromene?
The IUPAC name of bromobenzene;2H-chromene (CID 174449384) is bromobenzene;2H-chromene.
What is the SMILES notation for bromobenzene;2H-chromene?
The canonical SMILES for bromobenzene;2H-chromene is Brc1ccccc1.C1=Cc2ccccc2OC1.
What is the InChIKey of bromobenzene;2H-chromene?
The InChIKey is NQZPCXRNJWANQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C6H5Br/c1-2-6-9-8(4-1)5-3-7-10-9;7-6-4-2-1-3-5-6/h1-6H,7H2;1-5H.
What are the key properties of bromobenzene;2H-chromene?
bromobenzene;2H-chromene has a molecular weight of 289.17 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;2H-chromene is sourced from PubChem (CID 174449384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).