About (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane
(2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane (PubChem CID 174450081) has the molecular formula C19H38O3S4Si
and a molecular weight of 470.86 g/mol. Its IUPAC name is (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane.
Molecular Properties
| Compound Name | (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane |
| PubChem CID | 174450081 |
| Molecular Formula | C19H38O3S4Si |
| Molecular Weight | 470.86 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane |
| SMILES | C1CCCCC1.CCO[Si](OCC)(OCC)SSSSC1CC2CCC1C2 |
| InChI | InChI=1S/C13H26O3S4Si.C6H12/c1-4-14-21(15-5-2,16-6-3)20-19-18-17-13-10-11-7-8-12(13)9-11;1-2-4-6-5-3-1/h11-13H,4-10H2,1-3H3;1-6H2 |
| InChIKey | ZJAGIOJNCSUFIB-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.86 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane?
The IUPAC name of (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane (CID 174450081) is (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane.
What is the SMILES notation for (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane?
The canonical SMILES for (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane is C1CCCCC1.CCO[Si](OCC)(OCC)SSSSC1CC2CCC1C2.
What is the InChIKey of (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane?
The InChIKey is ZJAGIOJNCSUFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3S4Si.C6H12/c1-4-14-21(15-5-2,16-6-3)20-19-18-17-13-10-11-7-8-12(13)9-11;1-2-4-6-5-3-1/h11-13H,4-10H2,1-3H3;1-6H2.
What are the key properties of (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane?
(2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane has a molecular weight of 470.86 g/mol, XLogP of 7.74, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bicyclo[2.2.1]heptanyltetrasulfanyl)-triethoxysilane;cyclohexane is sourced from PubChem (CID 174450081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).