About lithium;1,1-dimethoxyethane;hydride
lithium;1,1-dimethoxyethane;hydride (PubChem CID 174450087) has the molecular formula C4H11LiO2
and a molecular weight of 98.07 g/mol. Its IUPAC name is lithium;1,1-dimethoxyethane;hydride.
Molecular Properties
| Compound Name | lithium;1,1-dimethoxyethane;hydride |
|---|
| PubChem CID | 174450087 |
|---|
| Molecular Formula | C4H11LiO2 |
|---|
| Molecular Weight | 98.07 g/mol |
|---|
| Exact Mass | 98.09 |
|---|
| IUPAC Name | lithium;1,1-dimethoxyethane;hydride |
|---|
| SMILES | COC(C)OC.[H-].[Li+] |
|---|
| InChI | InChI=1S/C4H10O2.Li.H/c1-4(5-2)6-3;;/h4H,1-3H3;;/q;+1;-1 |
|---|
| InChIKey | QIRQSMZKZDPWIV-UHFFFAOYSA-N |
|---|
| XLogP | -2.26 |
|---|
| TPSA | 18.46 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 7 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 98.07 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze lithium;1,1-dimethoxyethane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,1-dimethoxyethane;hydride?
The IUPAC name of lithium;1,1-dimethoxyethane;hydride (CID 174450087) is lithium;1,1-dimethoxyethane;hydride.
What is the SMILES notation for lithium;1,1-dimethoxyethane;hydride?
The canonical SMILES for lithium;1,1-dimethoxyethane;hydride is COC(C)OC.[H-].[Li+].
What is the InChIKey of lithium;1,1-dimethoxyethane;hydride?
The InChIKey is QIRQSMZKZDPWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.Li.H/c1-4(5-2)6-3;;/h4H,1-3H3;;/q;+1;-1.
What are the key properties of lithium;1,1-dimethoxyethane;hydride?
lithium;1,1-dimethoxyethane;hydride has a molecular weight of 98.07 g/mol, XLogP of -2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,1-dimethoxyethane;hydride is sourced from PubChem (CID 174450087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).