C5H10N6O5S — CID 174450453
N-(4,6-diamino-1,3,5-triazin-2-yl)acetamide;sulfuric acid (PubChem CID 174450453) has the molecular formula C5H10N6O5S and a molecular weight of 266.24 g/mol. Its IUPAC name is N-(4,6-diamino-1,3,5-triazin-2-yl)acetamide;sulfuric acid.
| Compound Name | N-(4,6-diamino-1,3,5-triazin-2-yl)acetamide;sulfuric acid |
|---|---|
| PubChem CID | 174450453 |
| Molecular Formula | C5H10N6O5S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | N-(4,6-diamino-1,3,5-triazin-2-yl)acetamide;sulfuric acid |
| SMILES | CC(=O)Nc1nc(N)nc(N)n1.O=S(=O)(O)O |
| InChI | InChI=1S/C5H8N6O.H2O4S/c1-2(12)8-5-10-3(6)9-4(7)11-5;1-5(2,3)4/h1H3,(H5,6,7,8,9,10,11,12);(H2,1,2,3,4) |
| InChIKey | GJBQLDUEUNUJRS-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 194.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|