C21H20N2 — CID 174450529
1H-imidazole;1,2,3,4-tetrahydrochrysene (PubChem CID 174450529) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 1H-imidazole;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1H-imidazole;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174450529 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1H-imidazole;1,2,3,4-tetrahydrochrysene |
| SMILES | c1c[nH]cn1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C3H4N2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-5-3-4-1/h1,3,5,7,9-12H,2,4,6,8H2;1-3H,(H,4,5) |
| InChIKey | YLBUOHZJXDWOGY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|