About (1-amino-2-oxohexyl) propanoate
(1-amino-2-oxohexyl) propanoate (PubChem CID 174450628) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is (1-amino-2-oxohexyl) propanoate.
Molecular Properties
| Compound Name | (1-amino-2-oxohexyl) propanoate |
| PubChem CID | 174450628 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (1-amino-2-oxohexyl) propanoate |
| SMILES | CCCCC(=O)C(N)OC(=O)CC |
| InChI | InChI=1S/C9H17NO3/c1-3-5-6-7(11)9(10)13-8(12)4-2/h9H,3-6,10H2,1-2H3 |
| InChIKey | KEILWTGPUPBQNO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-2-oxohexyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-2-oxohexyl) propanoate?
The IUPAC name of (1-amino-2-oxohexyl) propanoate (CID 174450628) is (1-amino-2-oxohexyl) propanoate.
What is the SMILES notation for (1-amino-2-oxohexyl) propanoate?
The canonical SMILES for (1-amino-2-oxohexyl) propanoate is CCCCC(=O)C(N)OC(=O)CC.
What is the InChIKey of (1-amino-2-oxohexyl) propanoate?
The InChIKey is KEILWTGPUPBQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-5-6-7(11)9(10)13-8(12)4-2/h9H,3-6,10H2,1-2H3.
What are the key properties of (1-amino-2-oxohexyl) propanoate?
(1-amino-2-oxohexyl) propanoate has a molecular weight of 187.24 g/mol, XLogP of 0.98, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-2-oxohexyl) propanoate is sourced from PubChem (CID 174450628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).