About ethyl 3-formamidobut-3-enoate
ethyl 3-formamidobut-3-enoate (PubChem CID 174451318) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is ethyl 3-formamidobut-3-enoate.
Molecular Properties
| Compound Name | ethyl 3-formamidobut-3-enoate |
| PubChem CID | 174451318 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | ethyl 3-formamidobut-3-enoate |
| SMILES | C=C(CC(=O)OCC)NC=O |
| InChI | InChI=1S/C7H11NO3/c1-3-11-7(10)4-6(2)8-5-9/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | BQBGXOHIKIFIED-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-formamidobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-formamidobut-3-enoate?
The IUPAC name of ethyl 3-formamidobut-3-enoate (CID 174451318) is ethyl 3-formamidobut-3-enoate.
What is the SMILES notation for ethyl 3-formamidobut-3-enoate?
The canonical SMILES for ethyl 3-formamidobut-3-enoate is C=C(CC(=O)OCC)NC=O.
What is the InChIKey of ethyl 3-formamidobut-3-enoate?
The InChIKey is BQBGXOHIKIFIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-3-11-7(10)4-6(2)8-5-9/h5H,2-4H2,1H3,(H,8,9).
What are the key properties of ethyl 3-formamidobut-3-enoate?
ethyl 3-formamidobut-3-enoate has a molecular weight of 157.17 g/mol, XLogP of 0.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-formamidobut-3-enoate is sourced from PubChem (CID 174451318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).