About 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid
2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid (PubChem CID 174451524) has the molecular formula C7H10O3S
and a molecular weight of 174.22 g/mol. Its IUPAC name is 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid |
| PubChem CID | 174451524 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid |
| SMILES | O=C(O)CC1=C(O)CCSC1 |
| InChI | InChI=1S/C7H10O3S/c8-6-1-2-11-4-5(6)3-7(9)10/h8H,1-4H2,(H,9,10) |
| InChIKey | BJZPZURKRKSWMS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid?
The IUPAC name of 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid (CID 174451524) is 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid is O=C(O)CC1=C(O)CCSC1.
What is the InChIKey of 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid?
The InChIKey is BJZPZURKRKSWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S/c8-6-1-2-11-4-5(6)3-7(9)10/h8H,1-4H2,(H,9,10).
What are the key properties of 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid?
2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid has a molecular weight of 174.22 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-3,6-dihydro-2H-thiopyran-5-yl)acetic acid is sourced from PubChem (CID 174451524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).