About azidobenzene;2-methylidenecyclohexan-1-one
azidobenzene;2-methylidenecyclohexan-1-one (PubChem CID 174451839) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is azidobenzene;2-methylidenecyclohexan-1-one.
Molecular Properties
| Compound Name | azidobenzene;2-methylidenecyclohexan-1-one |
| PubChem CID | 174451839 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | azidobenzene;2-methylidenecyclohexan-1-one |
| SMILES | C=C1CCCCC1=O.[N-]=[N+]=Nc1ccccc1 |
| InChI | InChI=1S/C7H10O.C6H5N3/c1-6-4-2-3-5-7(6)8;7-9-8-6-4-2-1-3-5-6/h1-5H2;1-5H |
| InChIKey | MCAZWZJWTLNQLR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidobenzene;2-methylidenecyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidobenzene;2-methylidenecyclohexan-1-one?
The IUPAC name of azidobenzene;2-methylidenecyclohexan-1-one (CID 174451839) is azidobenzene;2-methylidenecyclohexan-1-one.
What is the SMILES notation for azidobenzene;2-methylidenecyclohexan-1-one?
The canonical SMILES for azidobenzene;2-methylidenecyclohexan-1-one is C=C1CCCCC1=O.[N-]=[N+]=Nc1ccccc1.
What is the InChIKey of azidobenzene;2-methylidenecyclohexan-1-one?
The InChIKey is MCAZWZJWTLNQLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C6H5N3/c1-6-4-2-3-5-7(6)8;7-9-8-6-4-2-1-3-5-6/h1-5H2;1-5H.
What are the key properties of azidobenzene;2-methylidenecyclohexan-1-one?
azidobenzene;2-methylidenecyclohexan-1-one has a molecular weight of 229.28 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azidobenzene;2-methylidenecyclohexan-1-one is sourced from PubChem (CID 174451839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).