About disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate
disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate (PubChem CID 174452390) has the molecular formula C21H16Na2O4S
and a molecular weight of 410.40 g/mol. Its IUPAC name is disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate.
Molecular Properties
| Compound Name | disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate |
| PubChem CID | 174452390 |
| Molecular Formula | C21H16Na2O4S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate |
| SMILES | C=C1CC=c2ccccc2=C1c1cccc2ccccc12.O=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H16.2Na.H2O4S/c1-15-13-14-17-8-3-5-11-19(17)21(15)20-12-6-9-16-7-2-4-10-18(16)20;;;1-5(2,3)4/h2-12,14H,1,13H2;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | SOOPAMHURCBCDI-UHFFFAOYSA-L |
| XLogP | -3.55 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate?
The IUPAC name of disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate (CID 174452390) is disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate.
What is the SMILES notation for disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate?
The canonical SMILES for disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate is C=C1CC=c2ccccc2=C1c1cccc2ccccc12.O=S(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate?
The InChIKey is SOOPAMHURCBCDI-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H16.2Na.H2O4S/c1-15-13-14-17-8-3-5-11-19(17)21(15)20-12-6-9-16-7-2-4-10-18(16)20;;;1-5(2,3)4/h2-12,14H,1,13H2;;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate?
disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate has a molecular weight of 410.40 g/mol, XLogP of -3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-methylidene-4-naphthalen-1-yl-2H-naphthalene;sulfate is sourced from PubChem (CID 174452390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).