C26H29N — CID 174452743
2,3,4,5-tetrahydrochrysene;2,2,6-trimethyl-1H-pyridine (PubChem CID 174452743) has the molecular formula C26H29N and a molecular weight of 355.53 g/mol. Its IUPAC name is 2,3,4,5-tetrahydrochrysene;2,2,6-trimethyl-1H-pyridine.
| Compound Name | 2,3,4,5-tetrahydrochrysene;2,2,6-trimethyl-1H-pyridine |
|---|---|
| PubChem CID | 174452743 |
| Molecular Formula | C26H29N |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2,3,4,5-tetrahydrochrysene;2,2,6-trimethyl-1H-pyridine |
| SMILES | C1=c2ccc3c(c2CCC1)CC=c1ccccc1=3.CC1=CC=CC(C)(C)N1 |
| InChI | InChI=1S/C18H16.C8H13N/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-7-5-4-6-8(2,3)9-7/h1,3,5-7,9-10,12H,2,4,8,11H2;4-6,9H,1-3H3 |
| InChIKey | BSUTVYVTEBGEII-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |