molecular hydrogen;trichloromethylsilane

CH5Cl3Si — CID 174453234

IUPACmolecular hydrogen;trichloromethylsilane
SMILES[H][H].[SiH3]C(Cl)(Cl)Cl
InChIInChI=1S/CH3Cl3Si.H2/c2-1(3,4)5;/h5H3;1H
InChIKeyICFOXQWQTDWLPD-UHFFFAOYSA-N
MW151.50 g/mol
LogP0.93
Rot. Bonds

About molecular hydrogen;trichloromethylsilane

molecular hydrogen;trichloromethylsilane (PubChem CID 174453234) has the molecular formula CH5Cl3Si and a molecular weight of 151.50 g/mol. Its IUPAC name is molecular hydrogen;trichloromethylsilane.

Molecular Properties

Compound Namemolecular hydrogen;trichloromethylsilane
PubChem CID174453234
Molecular FormulaCH5Cl3Si
Molecular Weight151.50 g/mol
Exact Mass149.92
IUPAC Namemolecular hydrogen;trichloromethylsilane
SMILES[H][H].[SiH3]C(Cl)(Cl)Cl
InChIInChI=1S/CH3Cl3Si.H2/c2-1(3,4)5;/h5H3;1H
InChIKeyICFOXQWQTDWLPD-UHFFFAOYSA-N
XLogP0.93
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.50
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze molecular hydrogen;trichloromethylsilane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;trichloromethylsilane?
The IUPAC name of molecular hydrogen;trichloromethylsilane (CID 174453234) is molecular hydrogen;trichloromethylsilane.
What is the SMILES notation for molecular hydrogen;trichloromethylsilane?
The canonical SMILES for molecular hydrogen;trichloromethylsilane is [H][H].[SiH3]C(Cl)(Cl)Cl.
What is the InChIKey of molecular hydrogen;trichloromethylsilane?
The InChIKey is ICFOXQWQTDWLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3Cl3Si.H2/c2-1(3,4)5;/h5H3;1H.
What are the key properties of molecular hydrogen;trichloromethylsilane?
molecular hydrogen;trichloromethylsilane has a molecular weight of 151.50 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;trichloromethylsilane is sourced from PubChem (CID 174453234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).