About 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin
22-pyridin-2-yl-21,23-dihydro-5H-porphyrin (PubChem CID 174453514) has the molecular formula C25H19N5
and a molecular weight of 389.46 g/mol. Its IUPAC name is 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin.
Molecular Properties
| Compound Name | 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin |
| PubChem CID | 174453514 |
| Molecular Formula | C25H19N5 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin |
| SMILES | C1=CC2=NC1=Cc1ccc([nH]1)Cc1ccc(n1-c1ccccn1)C=c1ccc([nH]1)=C2 |
| InChI | InChI=1S/C25H19N5/c1-2-12-26-25(3-1)30-23-10-11-24(30)16-22-9-7-20(29-22)14-18-5-4-17(27-18)13-19-6-8-21(15-23)28-19/h1-15,28-29H,16H2 |
| InChIKey | NGBFRRPRFYXXOS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin?
The IUPAC name of 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin (CID 174453514) is 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin.
What is the SMILES notation for 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin?
The canonical SMILES for 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin is C1=CC2=NC1=Cc1ccc([nH]1)Cc1ccc(n1-c1ccccn1)C=c1ccc([nH]1)=C2.
What is the InChIKey of 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin?
The InChIKey is NGBFRRPRFYXXOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19N5/c1-2-12-26-25(3-1)30-23-10-11-24(30)16-22-9-7-20(29-22)14-18-5-4-17(27-18)13-19-6-8-21(15-23)28-19/h1-15,28-29H,16H2.
What are the key properties of 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin?
22-pyridin-2-yl-21,23-dihydro-5H-porphyrin has a molecular weight of 389.46 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 22-pyridin-2-yl-21,23-dihydro-5H-porphyrin is sourced from PubChem (CID 174453514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).