About 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate
3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate (PubChem CID 174453740) has the molecular formula C11H21ClN2O3
and a molecular weight of 264.75 g/mol. Its IUPAC name is 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate.
Molecular Properties
| Compound Name | 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate |
| PubChem CID | 174453740 |
| Molecular Formula | C11H21ClN2O3 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate |
| SMILES | CCC(N)C(C(N)=O)=C(C)C.COC(=O)CCl |
| InChI | InChI=1S/C8H16N2O.C3H5ClO2/c1-4-6(9)7(5(2)3)8(10)11;1-6-3(5)2-4/h6H,4,9H2,1-3H3,(H2,10,11);2H2,1H3 |
| InChIKey | HDMMFHYXONHHOZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate?
The IUPAC name of 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate (CID 174453740) is 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate.
What is the SMILES notation for 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate?
The canonical SMILES for 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate is CCC(N)C(C(N)=O)=C(C)C.COC(=O)CCl.
What is the InChIKey of 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate?
The InChIKey is HDMMFHYXONHHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C3H5ClO2/c1-4-6(9)7(5(2)3)8(10)11;1-6-3(5)2-4/h6H,4,9H2,1-3H3,(H2,10,11);2H2,1H3.
What are the key properties of 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate?
3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate has a molecular weight of 264.75 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-propan-2-ylidenepentanamide;methyl 2-chloroacetate is sourced from PubChem (CID 174453740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).