About silyl 2-hydroxy-2-methylsulfanylacetate
silyl 2-hydroxy-2-methylsulfanylacetate (PubChem CID 174454152) has the molecular formula C3H8O3SSi
and a molecular weight of 152.25 g/mol. Its IUPAC name is silyl 2-hydroxy-2-methylsulfanylacetate.
Molecular Properties
| Compound Name | silyl 2-hydroxy-2-methylsulfanylacetate |
| PubChem CID | 174454152 |
| Molecular Formula | C3H8O3SSi |
| Molecular Weight | 152.25 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | silyl 2-hydroxy-2-methylsulfanylacetate |
| SMILES | CSC(O)C(=O)O[SiH3] |
| InChI | InChI=1S/C3H8O3SSi/c1-7-3(5)2(4)6-8/h3,5H,1,8H3 |
| InChIKey | DQXZFDJLZHODQQ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.25 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze silyl 2-hydroxy-2-methylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyl 2-hydroxy-2-methylsulfanylacetate?
The IUPAC name of silyl 2-hydroxy-2-methylsulfanylacetate (CID 174454152) is silyl 2-hydroxy-2-methylsulfanylacetate.
What is the SMILES notation for silyl 2-hydroxy-2-methylsulfanylacetate?
The canonical SMILES for silyl 2-hydroxy-2-methylsulfanylacetate is CSC(O)C(=O)O[SiH3].
What is the InChIKey of silyl 2-hydroxy-2-methylsulfanylacetate?
The InChIKey is DQXZFDJLZHODQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3SSi/c1-7-3(5)2(4)6-8/h3,5H,1,8H3.
What are the key properties of silyl 2-hydroxy-2-methylsulfanylacetate?
silyl 2-hydroxy-2-methylsulfanylacetate has a molecular weight of 152.25 g/mol, XLogP of -1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silyl 2-hydroxy-2-methylsulfanylacetate is sourced from PubChem (CID 174454152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).