About [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane
[2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane (PubChem CID 174454754) has the molecular formula C13H20OSi
and a molecular weight of 220.39 g/mol. Its IUPAC name is [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane.
Molecular Properties
| Compound Name | [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane |
| PubChem CID | 174454754 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane |
| SMILES | C[SiH](C)C1(C=C2C=CC=C2)CCCCO1 |
| InChI | InChI=1S/C13H20OSi/c1-15(2)13(9-5-6-10-14-13)11-12-7-3-4-8-12/h3-4,7-8,11,15H,5-6,9-10H2,1-2H3 |
| InChIKey | BTQVAUZUJBYKOP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane?
The IUPAC name of [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane (CID 174454754) is [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane.
What is the SMILES notation for [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane?
The canonical SMILES for [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane is C[SiH](C)C1(C=C2C=CC=C2)CCCCO1.
What is the InChIKey of [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane?
The InChIKey is BTQVAUZUJBYKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20OSi/c1-15(2)13(9-5-6-10-14-13)11-12-7-3-4-8-12/h3-4,7-8,11,15H,5-6,9-10H2,1-2H3.
What are the key properties of [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane?
[2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane has a molecular weight of 220.39 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopenta-2,4-dien-1-ylidenemethyl)oxan-2-yl]-dimethylsilane is sourced from PubChem (CID 174454754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).