About hex-1-ene;1-phenylpiperidine-2-carbaldehyde
hex-1-ene;1-phenylpiperidine-2-carbaldehyde (PubChem CID 174454912) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is hex-1-ene;1-phenylpiperidine-2-carbaldehyde.
Molecular Properties
| Compound Name | hex-1-ene;1-phenylpiperidine-2-carbaldehyde |
| PubChem CID | 174454912 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | hex-1-ene;1-phenylpiperidine-2-carbaldehyde |
| SMILES | C=CCCCC.O=CC1CCCCN1c1ccccc1 |
| InChI | InChI=1S/C12H15NO.C6H12/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;1-3-5-6-4-2/h1-3,6-7,10,12H,4-5,8-9H2;3H,1,4-6H2,2H3 |
| InChIKey | CZXYNEKYIHBPTC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-1-ene;1-phenylpiperidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-1-ene;1-phenylpiperidine-2-carbaldehyde?
The IUPAC name of hex-1-ene;1-phenylpiperidine-2-carbaldehyde (CID 174454912) is hex-1-ene;1-phenylpiperidine-2-carbaldehyde.
What is the SMILES notation for hex-1-ene;1-phenylpiperidine-2-carbaldehyde?
The canonical SMILES for hex-1-ene;1-phenylpiperidine-2-carbaldehyde is C=CCCCC.O=CC1CCCCN1c1ccccc1.
What is the InChIKey of hex-1-ene;1-phenylpiperidine-2-carbaldehyde?
The InChIKey is CZXYNEKYIHBPTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.C6H12/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11;1-3-5-6-4-2/h1-3,6-7,10,12H,4-5,8-9H2;3H,1,4-6H2,2H3.
What are the key properties of hex-1-ene;1-phenylpiperidine-2-carbaldehyde?
hex-1-ene;1-phenylpiperidine-2-carbaldehyde has a molecular weight of 273.42 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-1-ene;1-phenylpiperidine-2-carbaldehyde is sourced from PubChem (CID 174454912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).