About 1,1-dichlorohydrazine;platinum
1,1-dichlorohydrazine;platinum (PubChem CID 174455887) has the molecular formula H2Cl2N2Pt
and a molecular weight of 296.01 g/mol. Its IUPAC name is 1,1-dichlorohydrazine;platinum.
Molecular Properties
| Compound Name | 1,1-dichlorohydrazine;platinum |
| PubChem CID | 174455887 |
| Molecular Formula | H2Cl2N2Pt |
| Molecular Weight | 296.01 g/mol |
| Exact Mass | 294.92 |
| IUPAC Name | 1,1-dichlorohydrazine;platinum |
| SMILES | NN(Cl)Cl.[Pt] |
| InChI | InChI=1S/Cl2H2N2.Pt/c1-4(2)3;/h3H2; |
| InChIKey | UMBVFJXXPCCBHX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.01 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichlorohydrazine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorohydrazine;platinum?
The IUPAC name of 1,1-dichlorohydrazine;platinum (CID 174455887) is 1,1-dichlorohydrazine;platinum.
What is the SMILES notation for 1,1-dichlorohydrazine;platinum?
The canonical SMILES for 1,1-dichlorohydrazine;platinum is NN(Cl)Cl.[Pt].
What is the InChIKey of 1,1-dichlorohydrazine;platinum?
The InChIKey is UMBVFJXXPCCBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2H2N2.Pt/c1-4(2)3;/h3H2;.
What are the key properties of 1,1-dichlorohydrazine;platinum?
1,1-dichlorohydrazine;platinum has a molecular weight of 296.01 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorohydrazine;platinum is sourced from PubChem (CID 174455887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).