C24H31N3O2 — CID 174456306
1-[4-[(3-cyclopentylphenyl)methylamino]phenyl]piperidin-2-one;formamide (PubChem CID 174456306) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-[4-[(3-cyclopentylphenyl)methylamino]phenyl]piperidin-2-one;formamide.
| Compound Name | 1-[4-[(3-cyclopentylphenyl)methylamino]phenyl]piperidin-2-one;formamide |
|---|---|
| PubChem CID | 174456306 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-[4-[(3-cyclopentylphenyl)methylamino]phenyl]piperidin-2-one;formamide |
| SMILES | NC=O.O=C1CCCCN1c1ccc(NCc2cccc(C3CCCC3)c2)cc1 |
| InChI | InChI=1S/C23H28N2O.CH3NO/c26-23-10-3-4-15-25(23)22-13-11-21(12-14-22)24-17-18-6-5-9-20(16-18)19-7-1-2-8-19;2-1-3/h5-6,9,11-14,16,19,24H,1-4,7-8,10,15,17H2;1H,(H2,2,3) |
| InChIKey | BMMSQJXDGLGHTN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|