About phenol;1-phosphorosonaphthalene
phenol;1-phosphorosonaphthalene (PubChem CID 174456748) has the molecular formula C16H13O2P
and a molecular weight of 268.25 g/mol. Its IUPAC name is phenol;1-phosphorosonaphthalene.
Molecular Properties
| Compound Name | phenol;1-phosphorosonaphthalene |
| PubChem CID | 174456748 |
| Molecular Formula | C16H13O2P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | phenol;1-phosphorosonaphthalene |
| SMILES | O=Pc1cccc2ccccc12.Oc1ccccc1 |
| InChI | InChI=1S/C10H7OP.C6H6O/c11-12-10-7-3-5-8-4-1-2-6-9(8)10;7-6-4-2-1-3-5-6/h1-7H;1-5,7H |
| InChIKey | QSDDRNCUZORRLQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenol;1-phosphorosonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;1-phosphorosonaphthalene?
The IUPAC name of phenol;1-phosphorosonaphthalene (CID 174456748) is phenol;1-phosphorosonaphthalene.
What is the SMILES notation for phenol;1-phosphorosonaphthalene?
The canonical SMILES for phenol;1-phosphorosonaphthalene is O=Pc1cccc2ccccc12.Oc1ccccc1.
What is the InChIKey of phenol;1-phosphorosonaphthalene?
The InChIKey is QSDDRNCUZORRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7OP.C6H6O/c11-12-10-7-3-5-8-4-1-2-6-9(8)10;7-6-4-2-1-3-5-6/h1-7H;1-5,7H.
What are the key properties of phenol;1-phosphorosonaphthalene?
phenol;1-phosphorosonaphthalene has a molecular weight of 268.25 g/mol, XLogP of 4.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;1-phosphorosonaphthalene is sourced from PubChem (CID 174456748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).