About N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride
N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride (PubChem CID 174458120) has the molecular formula C16H22ClN3O3S
and a molecular weight of 371.89 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride |
| PubChem CID | 174458120 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cc1oncc1N(CC1CCNCC1)S(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C16H21N3O3S.ClH/c1-13-16(11-18-22-13)19(12-14-7-9-17-10-8-14)23(20,21)15-5-3-2-4-6-15;/h2-6,11,14,17H,7-10,12H2,1H3;1H |
| InChIKey | MSSNUKRGVWLSJB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride?
The IUPAC name of N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride (CID 174458120) is N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride.
What is the SMILES notation for N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride?
The canonical SMILES for N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride is Cc1oncc1N(CC1CCNCC1)S(=O)(=O)c1ccccc1.Cl.
What is the InChIKey of N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride?
The InChIKey is MSSNUKRGVWLSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3S.ClH/c1-13-16(11-18-22-13)19(12-14-7-9-17-10-8-14)23(20,21)15-5-3-2-4-6-15;/h2-6,11,14,17H,7-10,12H2,1H3;1H.
What are the key properties of N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride?
N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride has a molecular weight of 371.89 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1,2-oxazol-4-yl)-N-(piperidin-4-ylmethyl)benzenesulfonamide;hydrochloride is sourced from PubChem (CID 174458120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).