C20H7F8N — CID 174458324
1-[2,3,5,6-tetrafluoro-4-(2,3,4,5-tetrafluorophenyl)phenyl]indole (PubChem CID 174458324) has the molecular formula C20H7F8N and a molecular weight of 413.27 g/mol. Its IUPAC name is 1-[2,3,5,6-tetrafluoro-4-(2,3,4,5-tetrafluorophenyl)phenyl]indole.
| Compound Name | 1-[2,3,5,6-tetrafluoro-4-(2,3,4,5-tetrafluorophenyl)phenyl]indole |
|---|---|
| PubChem CID | 174458324 |
| Molecular Formula | C20H7F8N |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-[2,3,5,6-tetrafluoro-4-(2,3,4,5-tetrafluorophenyl)phenyl]indole |
| SMILES | Fc1cc(-c2c(F)c(F)c(-n3ccc4ccccc43)c(F)c2F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H7F8N/c21-10-7-9(13(22)17(26)14(10)23)12-15(24)18(27)20(19(28)16(12)25)29-6-5-8-3-1-2-4-11(8)29/h1-7H |
| InChIKey | GSSKUYBRCVZNNP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|