About 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine
3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine (PubChem CID 174458398) has the molecular formula C13H30N2O3Si
and a molecular weight of 290.48 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine |
| PubChem CID | 174458398 |
| Molecular Formula | C13H30N2O3Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine |
| SMILES | CCCC1(OC)C(N)(CCN)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C13H30N2O3Si/c1-5-7-13(16-2)12(15,9-10-14)8-6-11-19(13,17-3)18-4/h5-11,14-15H2,1-4H3 |
| InChIKey | LQORVBGXIVEJIL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine?
The IUPAC name of 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine (CID 174458398) is 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine.
What is the SMILES notation for 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine?
The canonical SMILES for 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine is CCCC1(OC)C(N)(CCN)CCC[Si]1(OC)OC.
What is the InChIKey of 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine?
The InChIKey is LQORVBGXIVEJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O3Si/c1-5-7-13(16-2)12(15,9-10-14)8-6-11-19(13,17-3)18-4/h5-11,14-15H2,1-4H3.
What are the key properties of 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine?
3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine has a molecular weight of 290.48 g/mol, XLogP of 1.29, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-1,1,2-trimethoxy-2-propylsilinan-3-amine is sourced from PubChem (CID 174458398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).